C11H9ClN2O2S — CID 164888892
2-chloro-N-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide (PubChem CID 164888892) has the molecular formula C11H9ClN2O2S and a molecular weight of 268.73 g/mol. Its IUPAC name is 2-chloro-N-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide.
| Compound Name | 2-chloro-N-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide |
|---|---|
| PubChem CID | 164888892 |
| Molecular Formula | C11H9ClN2O2S |
| Molecular Weight | 268.73 g/mol |
| Exact Mass | 268.01 |
| IUPAC Name | 2-chloro-N-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]acetamide |
| SMILES | O=C(CCl)Nc1nc(-c2cccc(O)c2)cs1 |
| InChI | InChI=1S/C11H9ClN2O2S/c12-5-10(16)14-11-13-9(6-17-11)7-2-1-3-8(15)4-7/h1-4,6,15H,5H2,(H,13,14,16) |
| InChIKey | UNDRDIFDXLTTHR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.73 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|