C21H17ClN4O2S — CID 1489969
2-chloro-N-[1-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)pyrazol-5-yl]acetamide (PubChem CID 1489969) has the molecular formula C21H17ClN4O2S and a molecular weight of 424.91 g/mol. Its IUPAC name is 2-chloro-N-[1-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)pyrazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[1-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 1489969 |
| Molecular Formula | C21H17ClN4O2S |
| Molecular Weight | 424.91 g/mol |
| Exact Mass | 424.08 |
| IUPAC Name | 2-chloro-N-[1-[4-(3-hydroxyphenyl)-1,3-thiazol-2-yl]-3-(4-methylphenyl)pyrazol-5-yl]acetamide |
| SMILES | Cc1ccc(-c2cc(NC(=O)CCl)n(-c3nc(-c4cccc(O)c4)cs3)n2)cc1 |
| InChI | InChI=1S/C21H17ClN4O2S/c1-13-5-7-14(8-6-13)17-10-19(24-20(28)11-22)26(25-17)21-23-18(12-29-21)15-3-2-4-16(27)9-15/h2-10,12,27H,11H2,1H3,(H,24,28) |
| InChIKey | PROXXLCXGNDBEC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 80.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.91 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|