C22H19ClN4OS — CID 4873520
2-chloro-N-[3-(4-methylphenyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyrazol-5-yl]acetamide (PubChem CID 4873520) has the molecular formula C22H19ClN4OS and a molecular weight of 422.94 g/mol. Its IUPAC name is 2-chloro-N-[3-(4-methylphenyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyrazol-5-yl]acetamide.
| Compound Name | 2-chloro-N-[3-(4-methylphenyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyrazol-5-yl]acetamide |
|---|---|
| PubChem CID | 4873520 |
| Molecular Formula | C22H19ClN4OS |
| Molecular Weight | 422.94 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 2-chloro-N-[3-(4-methylphenyl)-1-[4-(4-methylphenyl)-1,3-thiazol-2-yl]pyrazol-5-yl]acetamide |
| SMILES | Cc1ccc(-c2csc(-n3nc(-c4ccc(C)cc4)cc3NC(=O)CCl)n2)cc1 |
| InChI | InChI=1S/C22H19ClN4OS/c1-14-3-7-16(8-4-14)18-11-20(25-21(28)12-23)27(26-18)22-24-19(13-29-22)17-9-5-15(2)6-10-17/h3-11,13H,12H2,1-2H3,(H,25,28) |
| InChIKey | NAKVEADHDCFYCS-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.94 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|