C12H13BCl4O2 — CID 79661640
4,4,5,5-tetramethyl-2-(2,3,5,6-tetrachlorophenyl)-1,3,2-dioxaborolane (PubChem CID 79661640) has the molecular formula C12H13BCl4O2 and a molecular weight of 341.86 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrachlorophenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrachlorophenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 79661640 |
| Molecular Formula | C12H13BCl4O2 |
| Molecular Weight | 341.86 g/mol |
| Exact Mass | 339.98 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(2,3,5,6-tetrachlorophenyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2c(Cl)c(Cl)cc(Cl)c2Cl)OC1(C)C |
| InChI | InChI=1S/C12H13BCl4O2/c1-11(2)12(3,4)19-13(18-11)8-9(16)6(14)5-7(15)10(8)17/h5H,1-4H3 |
| InChIKey | JJKORUUIVPCGAJ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.86 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|