C12H15BCl2O2 — CID 140776313
2-(2,3-dichloro-4,5,6-trideuteriophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 140776313) has the molecular formula C12H15BCl2O2 and a molecular weight of 275.99 g/mol. Its IUPAC name is 2-(2,3-dichloro-4,5,6-trideuteriophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(2,3-dichloro-4,5,6-trideuteriophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 140776313 |
| Molecular Formula | C12H15BCl2O2 |
| Molecular Weight | 275.99 g/mol |
| Exact Mass | 275.07 |
| IUPAC Name | 2-(2,3-dichloro-4,5,6-trideuteriophenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c(Cl)c(Cl)c(B2OC(C)(C)C(C)(C)O2)c1[2H] |
| InChI | InChI=1S/C12H15BCl2O2/c1-11(2)12(3,4)17-13(16-11)8-6-5-7-9(14)10(8)15/h5-7H,1-4H3/i5D,6D,7D |
| InChIKey | XJOWNMGMNMPVRL-CRSPMMAGSA-N |
| XLogP | 3.29 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.99 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|