C22H23BO2 — CID 177076655
2-[2,3,4,5,6,7-hexadeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 177076655) has the molecular formula C22H23BO2 and a molecular weight of 341.30 g/mol. Its IUPAC name is 2-[2,3,4,5,6,7-hexadeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-[2,3,4,5,6,7-hexadeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 177076655 |
| Molecular Formula | C22H23BO2 |
| Molecular Weight | 341.30 g/mol |
| Exact Mass | 341.25 |
| IUPAC Name | 2-[2,3,4,5,6,7-hexadeuterio-8-(2,3,4,5,6-pentadeuteriophenyl)naphthalen-1-yl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c([2H])c(-c2c([2H])c([2H])c([2H])c3c([2H])c([2H])c([2H])c(B4OC(C)(C)C(C)(C)O4)c23)c([2H])c1[2H] |
| InChI | InChI=1S/C22H23BO2/c1-21(2)22(3,4)25-23(24-21)19-15-9-13-17-12-8-14-18(20(17)19)16-10-6-5-7-11-16/h5-15H,1-4H3/i5D,6D,7D,8D,9D,10D,11D,12D,13D,14D,15D |
| InChIKey | XZNBUEPOEJXZLD-RFSRMPAJSA-N |
| XLogP | 4.81 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|