C22H21BO3 — CID 176840974
2-(1,2,3,4,5,6-hexadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (PubChem CID 176840974) has the molecular formula C22H21BO3 and a molecular weight of 350.26 g/mol. Its IUPAC name is 2-(1,2,3,4,5,6-hexadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane.
| Compound Name | 2-(1,2,3,4,5,6-hexadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 176840974 |
| Molecular Formula | C22H21BO3 |
| Molecular Weight | 350.26 g/mol |
| Exact Mass | 350.20 |
| IUPAC Name | 2-(1,2,3,4,5,6-hexadeuterionaphtho[1,2-b][1]benzofuran-7-yl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c2oc2cccc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C22H21BO3/c1-21(2)22(3,4)26-23(25-21)17-10-7-11-18-19(17)16-13-12-14-8-5-6-9-15(14)20(16)24-18/h5-13H,1-4H3/i5D,6D,8D,9D,12D,13D |
| InChIKey | BGJHKLOXRJFSKM-ZPMXTBTNSA-N |
| XLogP | 5.04 |
| TPSA | 31.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.26 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|