C44H26O — CID 176840904
15,16,17,18,20,21-hexadeuterio-9-(10-naphthalen-1-ylanthracen-9-yl)-12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene (PubChem CID 176840904) has the molecular formula C44H26O and a molecular weight of 576.73 g/mol. Its IUPAC name is 15,16,17,18,20,21-hexadeuterio-9-(10-naphthalen-1-ylanthracen-9-yl)-12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene.
| Compound Name | 15,16,17,18,20,21-hexadeuterio-9-(10-naphthalen-1-ylanthracen-9-yl)-12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
|---|---|
| PubChem CID | 176840904 |
| Molecular Formula | C44H26O |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.24 |
| IUPAC Name | 15,16,17,18,20,21-hexadeuterio-9-(10-naphthalen-1-ylanthracen-9-yl)-12-oxapentacyclo[11.8.0.02,11.03,8.014,19]henicosa-1(13),2(11),3,5,7,9,14,16,18,20-decaene |
| SMILES | [2H]c1c([2H])c([2H])c2c(c1[2H])c([2H])c([2H])c1c2oc2cc(-c3c4ccccc4c(-c4cccc5ccccc45)c4ccccc34)c3ccccc3c21 |
| InChI | InChI=1S/C44H26O/c1-3-15-29-27(12-1)14-11-23-32(29)41-34-19-7-9-21-36(34)42(37-22-10-8-20-35(37)41)39-26-40-43(33-18-6-5-17-31(33)39)38-25-24-28-13-2-4-16-30(28)44(38)45-40/h1-26H/i2D,4D,13D,16D,24D,25D |
| InChIKey | WCQRZPXJLCDHFP-LGZIWRMPSA-N |
| XLogP | 12.69 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 12.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|