C18H24BNO3 — CID 175991327
2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]propan-2-ol (PubChem CID 175991327) has the molecular formula C18H24BNO3 and a molecular weight of 313.21 g/mol. Its IUPAC name is 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]propan-2-ol.
| Compound Name | 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]propan-2-ol |
|---|---|
| PubChem CID | 175991327 |
| Molecular Formula | C18H24BNO3 |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 2-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)quinolin-4-yl]propan-2-ol |
| SMILES | CC(C)(O)c1ccnc2ccc(B3OC(C)(C)C(C)(C)O3)cc12 |
| InChI | InChI=1S/C18H24BNO3/c1-16(2,21)14-9-10-20-15-8-7-12(11-13(14)15)19-22-17(3,4)18(5,6)23-19/h7-11,21H,1-6H3 |
| InChIKey | IUYMKOFNVUDMRA-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|