C23H29BN2O2 — CID 172609173
2-(4-tert-butyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 172609173) has the molecular formula C23H29BN2O2 and a molecular weight of 376.31 g/mol. Its IUPAC name is 2-(4-tert-butyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 2-(4-tert-butyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 172609173 |
| Molecular Formula | C23H29BN2O2 |
| Molecular Weight | 376.31 g/mol |
| Exact Mass | 376.23 |
| IUPAC Name | 2-(4-tert-butyl-2-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | CC(C)(C)c1ccnc(-c2cc3cc(B4OC(C)(C)C(C)(C)O4)ccc3[nH]2)c1 |
| InChI | InChI=1S/C23H29BN2O2/c1-21(2,3)16-10-11-25-19(14-16)20-13-15-12-17(8-9-18(15)26-20)24-27-22(4,5)23(6,7)28-24/h8-14,26H,1-7H3 |
| InChIKey | GPSXSXQSTBRDNF-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.31 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|