C20H22BFN2O2 — CID 86682574
2-(5-fluoro-4-methyl-3-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole (PubChem CID 86682574) has the molecular formula C20H22BFN2O2 and a molecular weight of 352.22 g/mol. Its IUPAC name is 2-(5-fluoro-4-methyl-3-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole.
| Compound Name | 2-(5-fluoro-4-methyl-3-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
|---|---|
| PubChem CID | 86682574 |
| Molecular Formula | C20H22BFN2O2 |
| Molecular Weight | 352.22 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 2-(5-fluoro-4-methyl-3-pyridinyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-indole |
| SMILES | Cc1c(F)cncc1-c1cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2[nH]1 |
| InChI | InChI=1S/C20H22BFN2O2/c1-12-15(10-23-11-16(12)22)18-9-13-8-14(6-7-17(13)24-18)21-25-19(2,3)20(4,5)26-21/h6-11,24H,1-5H3 |
| InChIKey | KZANAZSFXDFZRD-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.22 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|