C25H40BNO4Si — CID 155893529
1-[5-[tert-butyl(dimethyl)silyl]oxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-2,2-dimethylpropan-1-one (PubChem CID 155893529) has the molecular formula C25H40BNO4Si and a molecular weight of 457.50 g/mol. Its IUPAC name is 1-[5-[tert-butyl(dimethyl)silyl]oxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-2,2-dimethylpropan-1-one.
| Compound Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-2,2-dimethylpropan-1-one |
|---|---|
| PubChem CID | 155893529 |
| Molecular Formula | C25H40BNO4Si |
| Molecular Weight | 457.50 g/mol |
| Exact Mass | 457.28 |
| IUPAC Name | 1-[5-[tert-butyl(dimethyl)silyl]oxy-7-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indol-1-yl]-2,2-dimethylpropan-1-one |
| SMILES | CC(C)(C)C(=O)n1ccc2cc(O[Si](C)(C)C(C)(C)C)cc(B3OC(C)(C)C(C)(C)O3)c21 |
| InChI | InChI=1S/C25H40BNO4Si/c1-22(2,3)21(28)27-14-13-17-15-18(29-32(11,12)23(4,5)6)16-19(20(17)27)26-30-24(7,8)25(9,10)31-26/h13-16H,1-12H3 |
| InChIKey | DGWKTUKSNQBAKA-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 49.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.50 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|