C28H51BO6Si3 — CID 67997098
CID 67997098 (PubChem CID 67997098) has the molecular formula C28H51BO6Si3 and a molecular weight of 578.78 g/mol.
| Compound Name | CID 67997098 |
|---|---|
| PubChem CID | 67997098 |
| Molecular Formula | C28H51BO6Si3 |
| Molecular Weight | 578.78 g/mol |
| Exact Mass | 578.31 |
| IUPAC Name | — |
| SMILES | C[Si]OC(O[Si]C)C(C)(C)[C@H](C)[C@H](C)Oc1cc(O[Si](C)(C)C(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C28H51BO6Si3/c1-19(26(6,7)24(31-36-12)32-37-13)20(2)30-22-16-21(29-34-27(8,9)28(10,11)35-29)17-23(18-22)33-38(14,15)25(3,4)5/h16-20,24H,1-15H3/t19-,20+/m1/s1 |
| InChIKey | IPNWEPUICSWCOE-UXHICEINSA-N |
| XLogP | 6.49 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.78 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|