C28H50BNO7Si — CID 90426060
[5-[tert-butyl(dimethyl)silyl]oxy-6-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,2-dimethylhexan-3-yl] carbamate (PubChem CID 90426060) has the molecular formula C28H50BNO7Si and a molecular weight of 551.61 g/mol. Its IUPAC name is [5-[tert-butyl(dimethyl)silyl]oxy-6-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,2-dimethylhexan-3-yl] carbamate.
| Compound Name | [5-[tert-butyl(dimethyl)silyl]oxy-6-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,2-dimethylhexan-3-yl] carbamate |
|---|---|
| PubChem CID | 90426060 |
| Molecular Formula | C28H50BNO7Si |
| Molecular Weight | 551.61 g/mol |
| Exact Mass | 551.34 |
| IUPAC Name | [5-[tert-butyl(dimethyl)silyl]oxy-6-[3-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenoxy]-2,2-dimethylhexan-3-yl] carbamate |
| SMILES | COc1cc(OCC(CC(OC(N)=O)C(C)(C)C)O[Si](C)(C)C(C)(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C28H50BNO7Si/c1-25(2,3)23(34-24(30)31)17-22(35-38(12,13)26(4,5)6)18-33-21-15-19(14-20(16-21)32-11)29-36-27(7,8)28(9,10)37-29/h14-16,22-23H,17-18H2,1-13H3,(H2,30,31) |
| InChIKey | LGFMWCUNYFEUJH-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 98.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.61 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|