C36H56BNO7Si — CID 90711851
tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate (PubChem CID 90711851) has the molecular formula C36H56BNO7Si and a molecular weight of 653.74 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 90711851 |
| Molecular Formula | C36H56BNO7Si |
| Molecular Weight | 653.74 g/mol |
| Exact Mass | 653.39 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl(dimethyl)silyl]oxy-3-phenoxypropyl]-N-[[(2S)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydro-2H-chromen-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CC(COc1ccccc1)O[Si](C)(C)C(C)(C)C)C[C@@H]1CCc2cc(B3OC(C)(C)C(C)(C)O3)ccc2O1 |
| InChI | InChI=1S/C36H56BNO7Si/c1-33(2,3)42-32(39)38(24-30(43-46(11,12)34(4,5)6)25-40-28-16-14-13-15-17-28)23-29-20-18-26-22-27(19-21-31(26)41-29)37-44-35(7,8)36(9,10)45-37/h13-17,19,21-22,29-30H,18,20,23-25H2,1-12H3/t29-,30?/m0/s1 |
| InChIKey | ZPGUIRANULLJPJ-UFXYQILXSA-N |
| XLogP | 7.39 |
| TPSA | 75.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.74 |
| LogP ≤ 5 | 7.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|