C23H33BF3NO5 — CID 162623449
tert-butyl N-(cyclopropylmethyl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methyl]carbamate (PubChem CID 162623449) has the molecular formula C23H33BF3NO5 and a molecular weight of 471.33 g/mol. Its IUPAC name is tert-butyl N-(cyclopropylmethyl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methyl]carbamate.
| Compound Name | tert-butyl N-(cyclopropylmethyl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methyl]carbamate |
|---|---|
| PubChem CID | 162623449 |
| Molecular Formula | C23H33BF3NO5 |
| Molecular Weight | 471.33 g/mol |
| Exact Mass | 471.24 |
| IUPAC Name | tert-butyl N-(cyclopropylmethyl)-N-[[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethoxy)phenyl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1ccc(B2OC(C)(C)C(C)(C)O2)cc1OC(F)(F)F)CC1CC1 |
| InChI | InChI=1S/C23H33BF3NO5/c1-20(2,3)31-19(29)28(13-15-8-9-15)14-16-10-11-17(12-18(16)30-23(25,26)27)24-32-21(4,5)22(6,7)33-24/h10-12,15H,8-9,13-14H2,1-7H3 |
| InChIKey | XIIMZNYJUNMPRH-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.33 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|