C25H39BN2O6 — CID 171815853
tert-butyl N-[2-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate (PubChem CID 171815853) has the molecular formula C25H39BN2O6 and a molecular weight of 474.41 g/mol. Its IUPAC name is tert-butyl N-[2-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 171815853 |
| Molecular Formula | C25H39BN2O6 |
| Molecular Weight | 474.41 g/mol |
| Exact Mass | 474.29 |
| IUPAC Name | tert-butyl N-[2-[2-methoxy-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]ethyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
| SMILES | COc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CCN(C[C@@H]1CCC(=O)N1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C25H39BN2O6/c1-23(2,3)32-22(30)28(16-19-11-12-21(29)27-19)14-13-17-9-10-18(15-20(17)31-8)26-33-24(4,5)25(6,7)34-26/h9-10,15,19H,11-14,16H2,1-8H3,(H,27,29)/t19-/m0/s1 |
| InChIKey | NXUQZOCWMTXXNA-IBGZPJMESA-N |
| XLogP | 3.05 |
| TPSA | 86.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.41 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|