C23H36BN3O6 — CID 170983542
tert-butyl N-[[2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate (PubChem CID 170983542) has the molecular formula C23H36BN3O6 and a molecular weight of 461.37 g/mol. Its IUPAC name is tert-butyl N-[[2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 170983542 |
| Molecular Formula | C23H36BN3O6 |
| Molecular Weight | 461.37 g/mol |
| Exact Mass | 461.27 |
| IUPAC Name | tert-butyl N-[[2-methoxy-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3-pyridinyl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
| SMILES | COc1nc(B2OC(C)(C)C(C)(C)O2)ccc1CN(C[C@@H]1CCC(=O)N1)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C23H36BN3O6/c1-21(2,3)31-20(29)27(14-16-10-12-18(28)25-16)13-15-9-11-17(26-19(15)30-8)24-32-22(4,5)23(6,7)33-24/h9,11,16H,10,12-14H2,1-8H3,(H,25,28)/t16-/m0/s1 |
| InChIKey | WAGWQVJPSWYFOS-INIZCTEOSA-N |
| XLogP | 2.41 |
| TPSA | 99.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.37 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|