C31H38BClN4O6 — CID 166515493
tert-butyl N-[[8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate (PubChem CID 166515493) has the molecular formula C31H38BClN4O6 and a molecular weight of 608.93 g/mol. Its IUPAC name is tert-butyl N-[[8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate.
| Compound Name | tert-butyl N-[[8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
|---|---|
| PubChem CID | 166515493 |
| Molecular Formula | C31H38BClN4O6 |
| Molecular Weight | 608.93 g/mol |
| Exact Mass | 608.26 |
| IUPAC Name | tert-butyl N-[[8-[2-chloro-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-4-oxopyrido[1,2-a]pyrimidin-3-yl]methyl]-N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cnc2cc(-c3cccc(B4OC(C)(C)C(C)(C)O4)c3Cl)ccn2c1=O)C[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C31H38BClN4O6/c1-29(2,3)41-28(40)36(18-21-11-12-25(38)35-21)17-20-16-34-24-15-19(13-14-37(24)27(20)39)22-9-8-10-23(26(22)33)32-42-30(4,5)31(6,7)43-32/h8-10,13-16,21H,11-12,17-18H2,1-7H3,(H,35,38)/t21-/m0/s1 |
| InChIKey | VXPDIIYNUYJGNL-NRFANRHFSA-N |
| XLogP | 4.33 |
| TPSA | 111.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.93 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|