C26H38BN3O6 — CID 170983553
tert-butyl N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-[2-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]ethyl]carbamate (PubChem CID 170983553) has the molecular formula C26H38BN3O6 and a molecular weight of 499.42 g/mol. Its IUPAC name is tert-butyl N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-[2-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-[2-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 170983553 |
| Molecular Formula | C26H38BN3O6 |
| Molecular Weight | 499.42 g/mol |
| Exact Mass | 499.29 |
| IUPAC Name | tert-butyl N-[[(2S)-5-oxopyrrolidin-2-yl]methyl]-N-[2-[3-oxo-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-isoindol-2-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCN1Cc2cc(B3OC(C)(C)C(C)(C)O3)ccc2C1=O)C[C@@H]1CCC(=O)N1 |
| InChI | InChI=1S/C26H38BN3O6/c1-24(2,3)34-23(33)30(16-19-9-11-21(31)28-19)13-12-29-15-17-14-18(8-10-20(17)22(29)32)27-35-25(4,5)26(6,7)36-27/h8,10,14,19H,9,11-13,15-16H2,1-7H3,(H,28,31)/t19-/m0/s1 |
| InChIKey | OJGOPTYMBBQRRZ-IBGZPJMESA-N |
| XLogP | 2.46 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|