C25H32BNO4 — CID 140960804
2-[2-(2-phenylpropan-2-yloxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one (PubChem CID 140960804) has the molecular formula C25H32BNO4 and a molecular weight of 421.35 g/mol. Its IUPAC name is 2-[2-(2-phenylpropan-2-yloxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one.
| Compound Name | 2-[2-(2-phenylpropan-2-yloxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 140960804 |
| Molecular Formula | C25H32BNO4 |
| Molecular Weight | 421.35 g/mol |
| Exact Mass | 421.24 |
| IUPAC Name | 2-[2-(2-phenylpropan-2-yloxy)ethyl]-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3H-isoindol-1-one |
| SMILES | CC(C)(OCCN1Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2C1=O)c1ccccc1 |
| InChI | InChI=1S/C25H32BNO4/c1-23(2,19-10-8-7-9-11-19)29-15-14-27-17-18-12-13-20(16-21(18)22(27)28)26-30-24(3,4)25(5,6)31-26/h7-13,16H,14-15,17H2,1-6H3 |
| InChIKey | PHOYYDADQGHFAK-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.35 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|