C15H19BN2O4 — CID 152791967
2-(aminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione (PubChem CID 152791967) has the molecular formula C15H19BN2O4 and a molecular weight of 302.14 g/mol. Its IUPAC name is 2-(aminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione.
| Compound Name | 2-(aminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 152791967 |
| Molecular Formula | C15H19BN2O4 |
| Molecular Weight | 302.14 g/mol |
| Exact Mass | 302.14 |
| IUPAC Name | 2-(aminomethyl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)isoindole-1,3-dione |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(=O)N(CN)C3=O)OC1(C)C |
| InChI | InChI=1S/C15H19BN2O4/c1-14(2)15(3,4)22-16(21-14)9-5-6-10-11(7-9)13(20)18(8-17)12(10)19/h5-7H,8,17H2,1-4H3 |
| InChIKey | SIBIIRLLFZIHGT-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.14 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|