C19H22BN3O3 — CID 69219240
3-amino-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one (PubChem CID 69219240) has the molecular formula C19H22BN3O3 and a molecular weight of 351.22 g/mol. Its IUPAC name is 3-amino-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one.
| Compound Name | 3-amino-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
|---|---|
| PubChem CID | 69219240 |
| Molecular Formula | C19H22BN3O3 |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.18 |
| IUPAC Name | 3-amino-9-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-5,11-dihydrobenzo[b][1,4]benzodiazepin-6-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)Nc2ccc(N)cc2NC3=O)OC1(C)C |
| InChI | InChI=1S/C19H22BN3O3/c1-18(2)19(3,4)26-20(25-18)11-5-7-13-15(9-11)22-14-8-6-12(21)10-16(14)23-17(13)24/h5-10,22H,21H2,1-4H3,(H,23,24) |
| InChIKey | DDUFJYVUGSILIW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 85.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|