C15H18BF2NO3 — CID 166092819
4,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one (PubChem CID 166092819) has the molecular formula C15H18BF2NO3 and a molecular weight of 309.12 g/mol. Its IUPAC name is 4,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one.
| Compound Name | 4,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 166092819 |
| Molecular Formula | C15H18BF2NO3 |
| Molecular Weight | 309.12 g/mol |
| Exact Mass | 309.13 |
| IUPAC Name | 4,4-difluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)C(F)(F)CNC3=O)OC1(C)C |
| InChI | InChI=1S/C15H18BF2NO3/c1-13(2)14(3,4)22-16(21-13)9-5-6-10-11(7-9)15(17,18)8-19-12(10)20/h5-7H,8H2,1-4H3,(H,19,20) |
| InChIKey | XYUVXMLVYWCPCM-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.12 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|