C15H19BFNO3 — CID 176912771
2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one (PubChem CID 176912771) has the molecular formula C15H19BFNO3 and a molecular weight of 291.13 g/mol. Its IUPAC name is 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one.
| Compound Name | 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 176912771 |
| Molecular Formula | C15H19BFNO3 |
| Molecular Weight | 291.13 g/mol |
| Exact Mass | 291.14 |
| IUPAC Name | 2-fluoro-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-3,4-dihydroisoquinolin-1-one |
| SMILES | CC1(C)OB(c2ccc3c(c2)CCN(F)C3=O)OC1(C)C |
| InChI | InChI=1S/C15H19BFNO3/c1-14(2)15(3,4)21-16(20-14)11-5-6-12-10(9-11)7-8-18(17)13(12)19/h5-6,9H,7-8H2,1-4H3 |
| InChIKey | XINSIZMVBFLDLY-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.13 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|