C23H29BN2O3 — CID 59216425
6-(dimethylamino)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydroisoquinolin-1-one (PubChem CID 59216425) has the molecular formula C23H29BN2O3 and a molecular weight of 392.31 g/mol. Its IUPAC name is 6-(dimethylamino)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydroisoquinolin-1-one.
| Compound Name | 6-(dimethylamino)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 59216425 |
| Molecular Formula | C23H29BN2O3 |
| Molecular Weight | 392.31 g/mol |
| Exact Mass | 392.23 |
| IUPAC Name | 6-(dimethylamino)-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-3,4-dihydroisoquinolin-1-one |
| SMILES | CN(C)c1ccc2c(c1)CCN(c1cccc(B3OC(C)(C)C(C)(C)O3)c1)C2=O |
| InChI | InChI=1S/C23H29BN2O3/c1-22(2)23(3,4)29-24(28-22)17-8-7-9-19(15-17)26-13-12-16-14-18(25(5)6)10-11-20(16)21(26)27/h7-11,14-15H,12-13H2,1-6H3 |
| InChIKey | KPGBQHZXFFBOTO-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 42.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|