C17H23BFNO3 — CID 171660351
8-fluoro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one (PubChem CID 171660351) has the molecular formula C17H23BFNO3 and a molecular weight of 319.19 g/mol. Its IUPAC name is 8-fluoro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one.
| Compound Name | 8-fluoro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one |
|---|---|
| PubChem CID | 171660351 |
| Molecular Formula | C17H23BFNO3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 8-fluoro-4,4-dimethyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2,3-dihydroisoquinolin-1-one |
| SMILES | CC1(C)CNC(=O)c2c(F)cc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C17H23BFNO3/c1-15(2)9-20-14(21)13-11(15)7-10(8-12(13)19)18-22-16(3,4)17(5,6)23-18/h7-8H,9H2,1-6H3,(H,20,21) |
| InChIKey | IGVSBNXOYRTSPK-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|