C14H18BFN2O3 — CID 118995345
4-fluoro-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-one (PubChem CID 118995345) has the molecular formula C14H18BFN2O3 and a molecular weight of 292.12 g/mol. Its IUPAC name is 4-fluoro-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-one.
| Compound Name | 4-fluoro-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-one |
|---|---|
| PubChem CID | 118995345 |
| Molecular Formula | C14H18BFN2O3 |
| Molecular Weight | 292.12 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 4-fluoro-3-methyl-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-benzimidazol-2-one |
| SMILES | Cn1c(=O)[nH]c2cc(B3OC(C)(C)C(C)(C)O3)cc(F)c21 |
| InChI | InChI=1S/C14H18BFN2O3/c1-13(2)14(3,4)21-15(20-13)8-6-9(16)11-10(7-8)17-12(19)18(11)5/h6-7H,1-5H3,(H,17,19) |
| InChIKey | OPDVDRFLXYIAGX-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 56.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.12 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|