C12H18BNO3 — CID 121232307
6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one (PubChem CID 121232307) has the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. Its IUPAC name is 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one.
| Compound Name | 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 121232307 |
| Molecular Formula | C12H18BNO3 |
| Molecular Weight | 235.09 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | 6-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyridin-2-one |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)cc(=O)[nH]1 |
| InChI | InChI=1S/C12H18BNO3/c1-8-6-9(7-10(15)14-8)13-16-11(2,3)12(4,5)17-13/h6-7H,1-5H3,(H,14,15) |
| InChIKey | ADEIFADUVUYRLK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.09 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|