About ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one
ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (PubChem CID 171659982) has the molecular formula C14H18FNO
and a molecular weight of 235.30 g/mol. Its IUPAC name is ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one.
Molecular Properties
| Compound Name | ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| PubChem CID | 171659982 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| SMILES | CC.Cc1cc(F)c2c(c1)C1(CC1)CNC2=O |
| InChI | InChI=1S/C12H12FNO.C2H6/c1-7-4-8-10(9(13)5-7)11(15)14-6-12(8)2-3-12;1-2/h4-5H,2-3,6H2,1H3,(H,14,15);1-2H3 |
| InChIKey | SRJPPYAZCKMBIM-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The IUPAC name of ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (CID 171659982) is ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one.
What is the SMILES notation for ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The canonical SMILES for ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one is CC.Cc1cc(F)c2c(c1)C1(CC1)CNC2=O.
What is the InChIKey of ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
The InChIKey is SRJPPYAZCKMBIM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12FNO.C2H6/c1-7-4-8-10(9(13)5-7)11(15)14-6-12(8)2-3-12;1-2/h4-5H,2-3,6H2,1H3,(H,14,15);1-2H3.
What are the key properties of ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one?
ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one has a molecular weight of 235.30 g/mol, XLogP of 2.94, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-fluoro-6-methylspiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one is sourced from PubChem (CID 171659982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).