C15H14N2O — CID 170542165
6-(1-isocyanocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one (PubChem CID 170542165) has the molecular formula C15H14N2O and a molecular weight of 238.29 g/mol. Its IUPAC name is 6-(1-isocyanocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one.
| Compound Name | 6-(1-isocyanocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
|---|---|
| PubChem CID | 170542165 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.29 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 6-(1-isocyanocyclopropyl)spiro[2,3-dihydroisoquinoline-4,1'-cyclopropane]-1-one |
| SMILES | [C-]#[N+]C1(c2ccc3c(c2)C2(CC2)CNC3=O)CC1 |
| InChI | InChI=1S/C15H14N2O/c1-16-15(6-7-15)10-2-3-11-12(8-10)14(4-5-14)9-17-13(11)18/h2-3,8H,4-7,9H2,(H,17,18) |
| InChIKey | DNBWIUBJQUYPJH-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 33.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.29 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|