C9H10FN — CID 123734909
4-fluoro-6-methyl-2,3-dihydro-1H-indole (PubChem CID 123734909) has the molecular formula C9H10FN and a molecular weight of 151.18 g/mol. Its IUPAC name is 4-fluoro-6-methyl-2,3-dihydro-1H-indole.
| Compound Name | 4-fluoro-6-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 123734909 |
| Molecular Formula | C9H10FN |
| Molecular Weight | 151.18 g/mol |
| Exact Mass | 151.08 |
| IUPAC Name | 4-fluoro-6-methyl-2,3-dihydro-1H-indole |
| SMILES | Cc1cc(F)c2c(c1)NCC2 |
| InChI | InChI=1S/C9H10FN/c1-6-4-8(10)7-2-3-11-9(7)5-6/h4-5,11H,2-3H2,1H3 |
| InChIKey | ZHDCIMSYQMIDCC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.18 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |