C9H11FN2 — CID 103594535
6-fluoro-7-methyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 103594535) has the molecular formula C9H11FN2 and a molecular weight of 166.20 g/mol. Its IUPAC name is 6-fluoro-7-methyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | 6-fluoro-7-methyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 103594535 |
| Molecular Formula | C9H11FN2 |
| Molecular Weight | 166.20 g/mol |
| Exact Mass | 166.09 |
| IUPAC Name | 6-fluoro-7-methyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | Cc1cc2c(cc1F)NCCN2 |
| InChI | InChI=1S/C9H11FN2/c1-6-4-8-9(5-7(6)10)12-3-2-11-8/h4-5,11-12H,2-3H2,1H3 |
| InChIKey | JYUASZKRTVFFBW-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.20 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |