C13H23FN2 — CID 162382189
ethane;5-fluoro-3,6-dimethyl-1,2-dihydrobenzimidazole (PubChem CID 162382189) has the molecular formula C13H23FN2 and a molecular weight of 226.34 g/mol. Its IUPAC name is ethane;5-fluoro-3,6-dimethyl-1,2-dihydrobenzimidazole.
| Compound Name | ethane;5-fluoro-3,6-dimethyl-1,2-dihydrobenzimidazole |
|---|---|
| PubChem CID | 162382189 |
| Molecular Formula | C13H23FN2 |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | ethane;5-fluoro-3,6-dimethyl-1,2-dihydrobenzimidazole |
| SMILES | CC.CC.Cc1cc2c(cc1F)N(C)CN2 |
| InChI | InChI=1S/C9H11FN2.2C2H6/c1-6-3-8-9(4-7(6)10)12(2)5-11-8;2*1-2/h3-4,11H,5H2,1-2H3;2*1-2H3 |
| InChIKey | AOQHJIWBTXABCJ-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |