C13H18F2N2 — CID 176723386
(2R)-1-(2,5-difluoro-4-methylphenyl)-2,4-dimethylpiperazine (PubChem CID 176723386) has the molecular formula C13H18F2N2 and a molecular weight of 240.30 g/mol. Its IUPAC name is (2R)-1-(2,5-difluoro-4-methylphenyl)-2,4-dimethylpiperazine.
| Compound Name | (2R)-1-(2,5-difluoro-4-methylphenyl)-2,4-dimethylpiperazine |
|---|---|
| PubChem CID | 176723386 |
| Molecular Formula | C13H18F2N2 |
| Molecular Weight | 240.30 g/mol |
| Exact Mass | 240.14 |
| IUPAC Name | (2R)-1-(2,5-difluoro-4-methylphenyl)-2,4-dimethylpiperazine |
| SMILES | Cc1cc(F)c(N2CCN(C)C[C@H]2C)cc1F |
| InChI | InChI=1S/C13H18F2N2/c1-9-6-12(15)13(7-11(9)14)17-5-4-16(3)8-10(17)2/h6-7,10H,4-5,8H2,1-3H3/t10-/m1/s1 |
| InChIKey | UAAQDVDGOZENHD-SNVBAGLBSA-N |
| XLogP | 2.41 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.30 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |