C15H14FN — CID 116698397
4-(3-fluoro-4-methylphenyl)-2,3-dihydro-1H-indole (PubChem CID 116698397) has the molecular formula C15H14FN and a molecular weight of 227.28 g/mol. Its IUPAC name is 4-(3-fluoro-4-methylphenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(3-fluoro-4-methylphenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698397 |
| Molecular Formula | C15H14FN |
| Molecular Weight | 227.28 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | 4-(3-fluoro-4-methylphenyl)-2,3-dihydro-1H-indole |
| SMILES | Cc1ccc(-c2cccc3c2CCN3)cc1F |
| InChI | InChI=1S/C15H14FN/c1-10-5-6-11(9-14(10)16)12-3-2-4-15-13(12)7-8-17-15/h2-6,9,17H,7-8H2,1H3 |
| InChIKey | REYIONUFJFYOCW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.28 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |