C18H15N — CID 116698319
4-naphthalen-2-yl-2,3-dihydro-1H-indole (PubChem CID 116698319) has the molecular formula C18H15N and a molecular weight of 245.33 g/mol. Its IUPAC name is 4-naphthalen-2-yl-2,3-dihydro-1H-indole.
| Compound Name | 4-naphthalen-2-yl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698319 |
| Molecular Formula | C18H15N |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.12 |
| IUPAC Name | 4-naphthalen-2-yl-2,3-dihydro-1H-indole |
| SMILES | c1cc2c(c(-c3ccc4ccccc4c3)c1)CCN2 |
| InChI | InChI=1S/C18H15N/c1-2-5-14-12-15(9-8-13(14)4-1)16-6-3-7-18-17(16)10-11-19-18/h1-9,12,19H,10-11H2 |
| InChIKey | WPYHVIFRRRXKJX-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |