C14H11ClFN — CID 116698400
4-(3-chloro-5-fluorophenyl)-2,3-dihydro-1H-indole (PubChem CID 116698400) has the molecular formula C14H11ClFN and a molecular weight of 247.70 g/mol. Its IUPAC name is 4-(3-chloro-5-fluorophenyl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(3-chloro-5-fluorophenyl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698400 |
| Molecular Formula | C14H11ClFN |
| Molecular Weight | 247.70 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 4-(3-chloro-5-fluorophenyl)-2,3-dihydro-1H-indole |
| SMILES | Fc1cc(Cl)cc(-c2cccc3c2CCN3)c1 |
| InChI | InChI=1S/C14H11ClFN/c15-10-6-9(7-11(16)8-10)12-2-1-3-14-13(12)4-5-17-14/h1-3,6-8,17H,4-5H2 |
| InChIKey | RWMWHHYLBBLQDM-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.70 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |