C12H13N3 — CID 116698328
4-(1-methylpyrazol-4-yl)-2,3-dihydro-1H-indole (PubChem CID 116698328) has the molecular formula C12H13N3 and a molecular weight of 199.26 g/mol. Its IUPAC name is 4-(1-methylpyrazol-4-yl)-2,3-dihydro-1H-indole.
| Compound Name | 4-(1-methylpyrazol-4-yl)-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 116698328 |
| Molecular Formula | C12H13N3 |
| Molecular Weight | 199.26 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 4-(1-methylpyrazol-4-yl)-2,3-dihydro-1H-indole |
| SMILES | Cn1cc(-c2cccc3c2CCN3)cn1 |
| InChI | InChI=1S/C12H13N3/c1-15-8-9(7-14-15)10-3-2-4-12-11(10)5-6-13-12/h2-4,7-8,13H,5-6H2,1H3 |
| InChIKey | GANGMGWBNIPLIF-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 29.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.26 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |