C14H15ClN2 — CID 169122125
5-pyridin-3-yl-1,2,3,4-tetrahydroquinoline;hydrochloride (PubChem CID 169122125) has the molecular formula C14H15ClN2 and a molecular weight of 246.74 g/mol. Its IUPAC name is 5-pyridin-3-yl-1,2,3,4-tetrahydroquinoline;hydrochloride.
| Compound Name | 5-pyridin-3-yl-1,2,3,4-tetrahydroquinoline;hydrochloride |
|---|---|
| PubChem CID | 169122125 |
| Molecular Formula | C14H15ClN2 |
| Molecular Weight | 246.74 g/mol |
| Exact Mass | 246.09 |
| IUPAC Name | 5-pyridin-3-yl-1,2,3,4-tetrahydroquinoline;hydrochloride |
| SMILES | Cl.c1cncc(-c2cccc3c2CCCN3)c1 |
| InChI | InChI=1S/C14H14N2.ClH/c1-5-12(11-4-2-8-15-10-11)13-6-3-9-16-14(13)7-1;/h1-2,4-5,7-8,10,16H,3,6,9H2;1H |
| InChIKey | YARYRMRTCCCJCS-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.74 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |