C14H14N2 — CID 56863104
5-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline (PubChem CID 56863104) has the molecular formula C14H14N2 and a molecular weight of 210.28 g/mol. Its IUPAC name is 5-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 5-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 56863104 |
| Molecular Formula | C14H14N2 |
| Molecular Weight | 210.28 g/mol |
| Exact Mass | 210.12 |
| IUPAC Name | 5-pyridin-3-yl-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1cncc(-c2cccc3c2CCNC3)c1 |
| InChI | InChI=1S/C14H14N2/c1-3-11-10-16-8-6-14(11)13(5-1)12-4-2-7-15-9-12/h1-5,7,9,16H,6,8,10H2 |
| InChIKey | CYSKDZPEICZKSH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.28 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |