About 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine
3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine (PubChem CID 142525776) has the molecular formula C14H16N2O
and a molecular weight of 228.30 g/mol. Its IUPAC name is 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine.
Molecular Properties
| Compound Name | 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine |
| PubChem CID | 142525776 |
| Molecular Formula | C14H16N2O |
| Molecular Weight | 228.30 g/mol |
| Exact Mass | 228.13 |
| IUPAC Name | 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine |
| SMILES | CN.c1cncc(-c2cccc3c2COC3)c1 |
| InChI | InChI=1S/C13H11NO.CH5N/c1-3-11-8-15-9-13(11)12(5-1)10-4-2-6-14-7-10;1-2/h1-7H,8-9H2;2H2,1H3 |
| InChIKey | ZIGDOUSSBMMIKN-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine?
The IUPAC name of 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine (CID 142525776) is 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine.
What is the SMILES notation for 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine?
The canonical SMILES for 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine is CN.c1cncc(-c2cccc3c2COC3)c1.
What is the InChIKey of 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine?
The InChIKey is ZIGDOUSSBMMIKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11NO.CH5N/c1-3-11-8-15-9-13(11)12(5-1)10-4-2-6-14-7-10;1-2/h1-7H,8-9H2;2H2,1H3.
What are the key properties of 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine?
3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine has a molecular weight of 228.30 g/mol, XLogP of 2.35, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,3-dihydro-2-benzofuran-4-yl)pyridine;methanamine is sourced from PubChem (CID 142525776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).