C17H14N2O — CID 46316451
(2,6-dipyridin-3-ylphenyl)methanol (PubChem CID 46316451) has the molecular formula C17H14N2O and a molecular weight of 262.31 g/mol. Its IUPAC name is (2,6-dipyridin-3-ylphenyl)methanol.
| Compound Name | (2,6-dipyridin-3-ylphenyl)methanol |
|---|---|
| PubChem CID | 46316451 |
| Molecular Formula | C17H14N2O |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | (2,6-dipyridin-3-ylphenyl)methanol |
| SMILES | OCc1c(-c2cccnc2)cccc1-c1cccnc1 |
| InChI | InChI=1S/C17H14N2O/c20-12-17-15(13-4-2-8-18-10-13)6-1-7-16(17)14-5-3-9-19-11-14/h1-11,20H,12H2 |
| InChIKey | BTNYGQNYPWHLIP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |