C12H9F2NO — CID 141349558
(4,5-difluoro-2-pyridin-3-ylphenyl)methanol (PubChem CID 141349558) has the molecular formula C12H9F2NO and a molecular weight of 221.21 g/mol. Its IUPAC name is (4,5-difluoro-2-pyridin-3-ylphenyl)methanol.
| Compound Name | (4,5-difluoro-2-pyridin-3-ylphenyl)methanol |
|---|---|
| PubChem CID | 141349558 |
| Molecular Formula | C12H9F2NO |
| Molecular Weight | 221.21 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | (4,5-difluoro-2-pyridin-3-ylphenyl)methanol |
| SMILES | OCc1cc(F)c(F)cc1-c1cccnc1 |
| InChI | InChI=1S/C12H9F2NO/c13-11-4-9(7-16)10(5-12(11)14)8-2-1-3-15-6-8/h1-6,16H,7H2 |
| InChIKey | STFSYJJAFIVXOT-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |