C16H12FN3 — CID 46316799
4-fluoro-2,6-dipyridin-3-ylaniline (PubChem CID 46316799) has the molecular formula C16H12FN3 and a molecular weight of 265.29 g/mol. Its IUPAC name is 4-fluoro-2,6-dipyridin-3-ylaniline.
| Compound Name | 4-fluoro-2,6-dipyridin-3-ylaniline |
|---|---|
| PubChem CID | 46316799 |
| Molecular Formula | C16H12FN3 |
| Molecular Weight | 265.29 g/mol |
| Exact Mass | 265.10 |
| IUPAC Name | 4-fluoro-2,6-dipyridin-3-ylaniline |
| SMILES | Nc1c(-c2cccnc2)cc(F)cc1-c1cccnc1 |
| InChI | InChI=1S/C16H12FN3/c17-13-7-14(11-3-1-5-19-9-11)16(18)15(8-13)12-4-2-6-20-10-12/h1-10H,18H2 |
| InChIKey | NLXPHHIEVHIASN-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.29 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|