C29H28F2N4O — CID 161419774
3-(5-fluoro-2-isocyanato-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-3-ylaniline (PubChem CID 161419774) has the molecular formula C29H28F2N4O and a molecular weight of 486.57 g/mol. Its IUPAC name is 3-(5-fluoro-2-isocyanato-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-3-ylaniline.
| Compound Name | 3-(5-fluoro-2-isocyanato-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-3-ylaniline |
|---|---|
| PubChem CID | 161419774 |
| Molecular Formula | C29H28F2N4O |
| Molecular Weight | 486.57 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | 3-(5-fluoro-2-isocyanato-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-3-ylaniline |
| SMILES | CC(C)c1cc(F)cc(-c2cccnc2)c1N.CC(C)c1cc(F)cc(-c2cccnc2)c1N=C=O |
| InChI | InChI=1S/C15H13FN2O.C14H15FN2/c1-10(2)13-6-12(16)7-14(15(13)18-9-19)11-4-3-5-17-8-11;1-9(2)12-6-11(15)7-13(14(12)16)10-4-3-5-17-8-10/h3-8,10H,1-2H3;3-9H,16H2,1-2H3 |
| InChIKey | VWONFFGPDOTAEQ-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 81.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.57 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|