C28H28BrF2N3 — CID 161461098
4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline (PubChem CID 161461098) has the molecular formula C28H28BrF2N3 and a molecular weight of 524.45 g/mol. Its IUPAC name is 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline.
| Compound Name | 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline |
|---|---|
| PubChem CID | 161461098 |
| Molecular Formula | C28H28BrF2N3 |
| Molecular Weight | 524.45 g/mol |
| Exact Mass | 523.14 |
| IUPAC Name | 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)pyridine;4-fluoro-2-propan-2-yl-6-pyridin-4-ylaniline |
| SMILES | CC(C)c1cc(F)cc(-c2ccncc2)c1Br.CC(C)c1cc(F)cc(-c2ccncc2)c1N |
| InChI | InChI=1S/C14H13BrFN.C14H15FN2/c1-9(2)12-7-11(16)8-13(14(12)15)10-3-5-17-6-4-10;1-9(2)12-7-11(15)8-13(14(12)16)10-3-5-17-6-4-10/h3-9H,1-2H3;3-9H,16H2,1-2H3 |
| InChIKey | WBUZGBUJZCGVEA-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.45 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|