C30H26BrF2N5 — CID 158631552
4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)-2-isocyanopyridine;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline (PubChem CID 158631552) has the molecular formula C30H26BrF2N5 and a molecular weight of 574.47 g/mol. Its IUPAC name is 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)-2-isocyanopyridine;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline.
| Compound Name | 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)-2-isocyanopyridine;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 158631552 |
| Molecular Formula | C30H26BrF2N5 |
| Molecular Weight | 574.47 g/mol |
| Exact Mass | 573.13 |
| IUPAC Name | 4-(2-bromo-5-fluoro-3-propan-2-ylphenyl)-2-isocyanopyridine;4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline |
| SMILES | [C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2Br)ccn1.[C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2N)ccn1 |
| InChI | InChI=1S/C15H12BrFN2.C15H14FN3/c1-9(2)12-7-11(17)8-13(15(12)16)10-4-5-19-14(6-10)18-3;1-9(2)12-7-11(16)8-13(15(12)17)10-4-5-19-14(6-10)18-3/h4-9H,1-2H3;4-9H,17H2,1-2H3 |
| InChIKey | HZGKMZXSZYCLGV-UHFFFAOYSA-N |
| XLogP | 9.47 |
| TPSA | 60.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.47 |
| LogP ≤ 5 | 9.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|