C21H24FN5O3S — CID 155613830
1-(1-ethylazetidin-3-yl)sulfonyl-3-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]urea (PubChem CID 155613830) has the molecular formula C21H24FN5O3S and a molecular weight of 445.52 g/mol. Its IUPAC name is 1-(1-ethylazetidin-3-yl)sulfonyl-3-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]urea.
| Compound Name | 1-(1-ethylazetidin-3-yl)sulfonyl-3-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]urea |
|---|---|
| PubChem CID | 155613830 |
| Molecular Formula | C21H24FN5O3S |
| Molecular Weight | 445.52 g/mol |
| Exact Mass | 445.16 |
| IUPAC Name | 1-(1-ethylazetidin-3-yl)sulfonyl-3-[4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylphenyl]urea |
| SMILES | [C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2NC(=O)NS(=O)(=O)C2CN(CC)C2)ccn1 |
| InChI | InChI=1S/C21H24FN5O3S/c1-5-27-11-16(12-27)31(29,30)26-21(28)25-20-17(13(2)3)9-15(22)10-18(20)14-6-7-24-19(8-14)23-4/h6-10,13,16H,5,11-12H2,1-3H3,(H2,25,26,28) |
| InChIKey | BICKVPAGEBXAIT-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 95.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.52 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|