C15H14FN3 — CID 154593403
4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline (PubChem CID 154593403) has the molecular formula C15H14FN3 and a molecular weight of 255.30 g/mol. Its IUPAC name is 4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline.
| Compound Name | 4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline |
|---|---|
| PubChem CID | 154593403 |
| Molecular Formula | C15H14FN3 |
| Molecular Weight | 255.30 g/mol |
| Exact Mass | 255.12 |
| IUPAC Name | 4-fluoro-2-(2-isocyano-4-pyridinyl)-6-propan-2-ylaniline |
| SMILES | [C-]#[N+]c1cc(-c2cc(F)cc(C(C)C)c2N)ccn1 |
| InChI | InChI=1S/C15H14FN3/c1-9(2)12-7-11(16)8-13(15(12)17)10-4-5-19-14(6-10)18-3/h4-9H,17H2,1-2H3 |
| InChIKey | ZINIMCGUVHSYDO-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 43.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.30 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|